CAS 814-88-0

[Ethanedioato(2-)-κO1,κO2]cadmium

Description:

Ethanedioato(2-)-κO1,κO2]cadmium, commonly known as cadmium oxalate, is an inorganic compound with the formula CdC2O4. It is characterized by its coordination complex structure, where cadmium ions are coordinated to oxalate ligands. This compound typically appears as a white crystalline solid and is sparingly soluble in water. Cadmium oxalate is known for its potential applications in various fields, including materials science and analytical chemistry. It exhibits properties such as thermal stability and can decompose upon heating, releasing carbon dioxide and cadmium oxide. The compound is of interest due to its interactions with biological systems, particularly concerning cadmium's toxicity and its implications in environmental chemistry. Safety precautions are essential when handling cadmium compounds, as cadmium is a toxic heavy metal that poses health risks upon exposure. Overall, cadmium oxalate serves as a significant example of coordination chemistry and the study of metal-organic interactions.

Formula: C₂CdO₄

InChI: InChI=1S/C2H2O4.Cd/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2

InChI key: InChIKey=RMCKOIXJLDOSOT-UHFFFAOYSA-L

SMILES: O=C1C(=O)O[Cd]O1

Synonyms:

• [Ethanedioato(2-)-κO1,κO2]cadmium
• Cadmium, [ethanedioato(2-)-κO1,κO2]-
• Oxalic acid, cadmium salt (1:1)
• Ethanedioic acid, cadmium salt (1:1)
• Cadmium oxalate