CAS 814-98-2
:1,1,2,2-Tetramethyldisilane
Description:
1,1,2,2-Tetramethyldisilane is an organosilicon compound characterized by its unique structure, which consists of two silicon atoms bonded to four methyl groups. Its chemical formula is C6H18Si2, indicating a relatively low molecular weight. This compound is typically a colorless, volatile liquid with a distinctive odor, and it is known for its high reactivity due to the presence of silicon-silicon bonds. 1,1,2,2-Tetramethyldisilane is often used as a precursor in the synthesis of silicon-containing materials and in various applications in the semiconductor industry, particularly in the deposition of silicon films. It exhibits properties such as low surface tension and good thermal stability, making it suitable for use in chemical vapor deposition processes. Additionally, it is soluble in organic solvents, which enhances its utility in various chemical reactions. Safety precautions are necessary when handling this compound, as it can be flammable and may pose health risks if inhaled or ingested.
Formula:C4H14Si2
InChI:InChI=1S/C4H14Si2/c1-5(2)6(3)4/h5-6H,1-4H3
InChI key:InChIKey=RDWAGGBALVFUHB-UHFFFAOYSA-N
SMILES:[SiH]([SiH](C)C)(C)C
Synonyms:- Disilane, 1,1,2,2-tetramethyl-
- sym-Tetramethyldisilane
- 1,1,2,2-Tetramethyldisilane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
sym-Tetramethyldisilane
CAS:Controlled ProductFormula:C4H14Si2Color and Shape:NeatMolecular weight:118.325
