CAS 81403-70-5

N-[3-(Methylamino)propyl]cyclopentanecarboxamide

Description:

N-[3-(Methylamino)propyl]cyclopentanecarboxamide, identified by its CAS number 81403-70-5, is a chemical compound characterized by its unique structure, which includes a cyclopentane ring and an amide functional group. This compound features a propyl chain with a methylamino group, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amide group, which can engage in hydrogen bonding. The compound's molecular structure suggests it may interact with biological systems, making it of interest in medicinal chemistry and pharmacology. Its properties, such as melting point, boiling point, and specific reactivity, would depend on the purity and specific conditions under which it is studied. As with many amides, it may exhibit stability under various conditions, but it could also be susceptible to hydrolysis in the presence of strong acids or bases. Overall, N-[3-(Methylamino)propyl]cyclopentanecarboxamide represents a class of compounds that could have diverse applications in research and industry.

Formula: C₁₀H₂₀N₂O

InChI: InChI=1S/C10H20N2O/c1-11-7-4-8-12-10(13)9-5-2-3-6-9/h9,11H,2-8H2,1H3,(H,12,13)

InChI key: InChIKey=CJFWEGQDNSOAGZ-UHFFFAOYSA-N

SMILES: C(NCCCNC)(=O)C1CCCC1

Synonyms:

• N-[3-(Methylamino)propyl]cyclopentanecarboxamide
• Cyclopentanecarboxamide, N-[3-(methylamino)propyl]-