CymitQuimica logo

CAS 81409-92-9

:

(8beta,10xi)-N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)-6-propylergoline-8-carboxamide

Description:
The chemical substance with the name "(8beta,10xi)-N-[3-(dimethylamino)propyl]-N-(ethylcarbamoyl)-6-propylergoline-8-carboxamide" and CAS number "81409-92-9" is a synthetic compound belonging to the ergoline class, which is characterized by a tetracyclic structure derived from lysergic acid. This compound features a complex molecular structure that includes a dimethylamino group and an ethylcarbamoyl moiety, contributing to its potential pharmacological properties. Ergoline derivatives are often studied for their effects on the central nervous system, and they may exhibit various biological activities, including interactions with neurotransmitter receptors. The presence of the propyl and dimethylamino groups suggests potential lipophilicity, which can influence the compound's bioavailability and ability to cross biological membranes. While specific pharmacological data may vary, compounds of this nature are typically investigated for their therapeutic potential in areas such as psychiatry and neurology. As with any chemical substance, safety and regulatory considerations are paramount, and thorough research is essential to understand its full profile.
Formula:C26H39N5O2
InChI:InChI=1/C26H39N5O2/c1-5-11-30-17-19(25(32)31(26(33)27-6-2)13-8-12-29(3)4)14-21-20-9-7-10-22-24(20)18(16-28-22)15-23(21)30/h7,9-10,16,19,21,23,28H,5-6,8,11-15,17H2,1-4H3,(H,27,33)/t19-,21?,23-/m1/s1
SMILES:CCCN1C[C@@H](CC2c3cccc4c3c(C[C@@H]12)c[nH]4)C(=O)N(CCCN(C)C)C(=NCC)O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.