CAS 81420-42-0
:bis(2-nitrophenyl) carbonate
Description:
Bis(2-nitrophenyl) carbonate is an organic compound characterized by its structure, which features two nitrophenyl groups attached to a carbonate moiety. This compound is typically a yellow crystalline solid, reflecting the presence of the nitro groups, which are known to impart color. It is soluble in organic solvents but has limited solubility in water due to its hydrophobic nature. The presence of nitro groups contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Bis(2-nitrophenyl) carbonate can be used as an intermediate in organic synthesis and may also exhibit properties that are useful in materials science, particularly in the development of polymers or as a reagent in the preparation of other chemical compounds. Safety precautions should be taken when handling this substance, as it may pose health risks, including toxicity and environmental hazards. Proper storage and disposal methods are essential to mitigate any potential risks associated with its use.
Formula:C13H8N2O7
InChI:InChI=1/C13H8N2O7/c16-13(21-11-7-3-1-5-9(11)14(17)18)22-12-8-4-2-6-10(12)15(19)20/h1-8H
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
