
CAS 814254-63-2
:1-Aminocyclooctanemethanol
Description:
1-Aminocyclooctanemethanol is an organic compound characterized by its unique structure, which includes a cyclooctane ring, an amino group, and a hydroxymethyl group. This compound is classified as an amine and an alcohol, which contributes to its potential reactivity and solubility properties. The presence of the amino group allows for hydrogen bonding, enhancing its solubility in polar solvents, while the cyclooctane ring provides a degree of rigidity and strain that can influence its chemical behavior. Typically, compounds like 1-Aminocyclooctanemethanol may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The compound's molecular structure suggests potential applications in various fields, including pharmaceuticals and materials science. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Safety and handling considerations should also be taken into account, as with any chemical substance, to ensure proper laboratory practices.
Formula:C9H19NO
InChI:InChI=1S/C9H19NO/c10-9(8-11)6-4-2-1-3-5-7-9/h11H,1-8,10H2
InChI key:InChIKey=QKGFFCDDDREERJ-UHFFFAOYSA-N
SMILES:C(O)C1(N)CCCCCCC1
Synonyms:- Cyclooctanemethanol, 1-amino-
- 1-Aminocyclooctanemethanol
- (1-Aminocyclooctyl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.