
CAS 81438-40-6
:1-Methylethyl N-3-pyridinylcarbamate
Description:
1-Methylethyl N-3-pyridinylcarbamate, also known by its CAS number 81438-40-6, is a chemical compound that belongs to the class of carbamates. This substance typically exhibits characteristics common to carbamates, such as being a colorless to pale yellow liquid or solid, depending on its purity and form. It is generally soluble in organic solvents and may have limited solubility in water. The presence of the pyridine ring contributes to its potential biological activity, making it of interest in various fields, including agriculture and pharmaceuticals. The compound may act as a pesticide or herbicide, leveraging its ability to interact with biological systems. Its chemical structure suggests that it may participate in hydrogen bonding and other intermolecular interactions, influencing its reactivity and stability. Safety data should be consulted for handling and exposure risks, as carbamates can exhibit varying degrees of toxicity. Overall, 1-Methylethyl N-3-pyridinylcarbamate represents a compound with specific functional properties that can be utilized in different applications.
Formula:C9H12N2O2
InChI:InChI=1S/C9H12N2O2/c1-7(2)13-9(12)11-8-4-3-5-10-6-8/h3-7H,1-2H3,(H,11,12)
InChI key:InChIKey=HLIJYKKGWDBBDX-UHFFFAOYSA-N
SMILES:N(C(OC(C)C)=O)C=1C=CC=NC1
Synonyms:- NSC 191939
- Carbamic acid, N-3-pyridinyl-, 1-methylethyl ester
- Isopropyl (pyridin-3-yl)carbamate
- Carbamic acid, 3-pyridinyl-, 1-methylethyl ester
- 1-Methylethyl N-3-pyridinylcarbamate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.