CAS 81438-50-8

2,5-Dimethylimidazo[1,2-a]pyridine-3-carboxylic acid

Description:

2,5-Dimethylimidazo[1,2-a]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its imidazo-pyridine structure, which includes a fused imidazole and pyridine ring system. This compound features two methyl groups at the 2 and 5 positions of the imidazole ring and a carboxylic acid functional group at the 3 position of the pyridine ring. It is known for its potential biological activity and has been studied for its role in the formation of mutagenic compounds, particularly in cooked meats. The presence of the carboxylic acid group contributes to its acidity and solubility in polar solvents. Additionally, the compound may exhibit various chemical reactivity patterns typical of heterocycles, including electrophilic substitution and nucleophilic attack. Its structural characteristics suggest potential applications in medicinal chemistry and the study of carcinogenic mechanisms. However, specific safety and handling guidelines should be followed due to its biological implications.

Formula: C₁₀H₁₀N₂O₂

InChI: InChI=1S/C10H10N2O2/c1-6-4-3-5-8-11-7(2)9(10(13)14)12(6)8/h3-5H,1-2H3,(H,13,14)

InChI key: InChIKey=JQXZWCPOVHFSAC-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1N2C(=NC1C)C=CC=C2C

Synonyms:

• Imidazo[1,2-a]pyridine-3-carboxylic acid, 2,5-dimethyl-
• 2,5-Dimethylimidazo[1,2-a]pyridine-3-carboxylic acid