CymitQuimica logo

CAS 81438-61-1

:

Imidazo[1,2-a]pyridine-3-carboxylic acid, 2-methyl-6-nitro-

Description:
Imidazo[1,2-a]pyridine-3-carboxylic acid, 2-methyl-6-nitro- is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures. This compound features a carboxylic acid functional group, which contributes to its acidity and potential reactivity. The presence of a methyl group at the 2-position and a nitro group at the 6-position of the pyridine ring introduces specific electronic and steric effects, influencing its chemical behavior and interactions. Typically, such compounds exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure allows for various potential applications, including as intermediates in organic synthesis or as pharmacological agents. Additionally, the compound's properties, such as solubility, melting point, and stability, can vary based on environmental conditions and the presence of other functional groups. Overall, imidazo[1,2-a]pyridine-3-carboxylic acid, 2-methyl-6-nitro- represents a class of compounds with diverse applications in research and industry.
Formula:C9H7N3O4
InChI:InChI=1S/C9H7N3O4/c1-5-8(9(13)14)11-4-6(12(15)16)2-3-7(11)10-5/h2-4H,1H3,(H,13,14)
InChI key:InChIKey=WQIZDHFHJFLOOY-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N2C(=NC1C)C=CC(N(=O)=O)=C2
Synonyms:
  • 2-Methyl-6-nitroimidazo[1,2-a]pyridine-3-carboxylic acid
  • Imidazo[1,2-a]pyridine-3-carboxylic acid, 2-methyl-6-nitro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.