CAS 81443-45-0
:(3'-methoxybiphenyl-4-yl)methanol
Description:
(3'-Methoxybiphenyl-4-yl)methanol, with the CAS number 81443-45-0, is an organic compound characterized by its biphenyl structure, which consists of two phenyl rings connected by a single bond. The presence of a methoxy group (-OCH3) at the 3' position of one of the phenyl rings contributes to its chemical properties, enhancing its solubility in organic solvents and potentially influencing its reactivity. The hydroxymethyl group (-CH2OH) at the 4-position of the biphenyl moiety provides the compound with alcohol characteristics, allowing for hydrogen bonding and increasing its polarity. This compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry and material science. Its synthesis typically involves reactions that form carbon-carbon bonds and functional group modifications, and it can be analyzed using techniques such as NMR spectroscopy and mass spectrometry to confirm its structure and purity. Overall, (3'-methoxybiphenyl-4-yl)methanol is a versatile compound with potential applications in various fields.
Formula:C14H14O2
InChI:InChI=1/C14H14O2/c1-16-14-4-2-3-13(9-14)12-7-5-11(10-15)6-8-12/h2-9,15H,10H2,1H3
SMILES:COc1cccc(c1)c1ccc(cc1)CO
Synonyms:- [1,1'-Biphenyl]-4-methanol, 3'-methoxy-
- (3'-Methoxybiphenyl-4-yl)methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
