
CAS 81443-73-4
:rel-(4Z)-7-[(1R,2R,5S)-5-([1,1′-Biphenyl]-4-ylmethoxy)-2-(4-morpholinyl)-3-oxocyclopentyl]-4-heptenoic acid
Description:
The chemical substance known as rel-(4Z)-7-[(1R,2R,5S)-5-([1,1′-Biphenyl]-4-ylmethoxy)-2-(4-morpholinyl)-3-oxocyclopentyl]-4-heptenoic acid, with the CAS number 81443-73-4, is characterized by its complex molecular structure, which includes multiple functional groups and stereocenters. This compound features a heptenoic acid backbone, indicating the presence of a long carbon chain with a double bond, specifically in the Z configuration. The molecule also contains a morpholine ring, which is a six-membered ring containing oxygen and nitrogen, contributing to its potential biological activity. The biphenyl moiety suggests that it may exhibit unique electronic properties and interactions due to the aromatic nature of the biphenyl group. The stereochemistry, indicated by the specific R and S configurations, plays a crucial role in determining the compound's reactivity and interaction with biological targets. Overall, this substance may be of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents.
Formula:C29H35NO5
InChI:InChI=1/C29H35NO5/c31-26-20-27(35-21-22-12-14-24(15-13-22)23-8-4-3-5-9-23)25(10-6-1-2-7-11-28(32)33)29(26)30-16-18-34-19-17-30/h1-5,8-9,12-15,25,27,29H,6-7,10-11,16-21H2,(H,32,33)/b2-1-/t25-,27-,29+/s2
InChI key:InChIKey=IOFUFYLETVNNRF-AISOYUTNNA-N
SMILES:C(C/C=C\CCC(O)=O)[C@H]1[C@@H](C(=O)C[C@H]1OCC2=CC=C(C=C2)C3=CC=CC=C3)N4CCOCC4
Synonyms:- 4-Heptenoic acid, 7-[5-([1,1′-biphenyl]-4-ylmethoxy)-2-(4-morpholinyl)-3-oxocyclopentyl]-, [1α(Z),2β,5α]-(±)-
- rel-(4Z)-7-[(1R,2R,5S)-5-([1,1′-Biphenyl]-4-ylmethoxy)-2-(4-morpholinyl)-3-oxocyclopentyl]-4-heptenoic acid
- 4-Heptenoic acid, 7-[(1R,2R,5S)-5-([1,1′-biphenyl]-4-ylmethoxy)-2-(4-morpholinyl)-3-oxocyclopentyl]-, (4Z)-rel-
- AH 23848B
- AH 23848
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
AH 23848
CAS:<p>AH 23848: Thromboxane antagonist; speeds up iNOS degradation; dampens cAMP in mesangial cells.</p>Formula:C29H35NO5Color and Shape:SolidMolecular weight:477.59
