CAS 81449-93-6

Ethyl 2-chlorothiazole-5-carboxylate

Description:

Ethyl 2-chlorothiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of a chlorine atom at the 2-position of the thiazole ring enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Ethyl 2-chlorothiazole-5-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it suitable for applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₆H₆ClNO₂S

InChI: InChI=1/C6H6ClNO2S/c1-2-10-5(9)4-3-8-6(7)11-4/h3H,2H2,1H3

SMILES: CCOC(=O)c1cnc(Cl)s1

Synonyms:

• Ethyl 2-chloro-5-thiazolecarboxylate
• Ethyl 2-Chloro-1,3-Thiazole-5-Carboxylate

Ethyl 2-chlorothiazole-5-carboxylate

CAS: 81449-93-6

Formula: C₆H₆ClNO₂S

Purity: 96%

Color and Shape: Liquid

Molecular weight: 191.6353

Ref: IN-DA0052C3

Ethyl 2-chlorothiazole-5-carboxylate

CAS: 81449-93-6

Ethyl 2-chlorothiazole-5-carboxylate

Purity: 98%

Molecular weight: 191.64g/mol

Ref: 54-OR953268

Ethyl 2-chlorothiazole-5-carboxylate

CAS: 81449-93-6

Formula: C₆H₆ClNO₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 191.63

Ref: 10-F076211