CymitQuimica logo

CAS 81449-93-6

:

Ethyl 2-chlorothiazole-5-carboxylate

Description:
Ethyl 2-chlorothiazole-5-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen atoms. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of a chlorine atom at the 2-position of the thiazole ring enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Ethyl 2-chlorothiazole-5-carboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents, which makes it suitable for applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C6H6ClNO2S
InChI:InChI=1/C6H6ClNO2S/c1-2-10-5(9)4-3-8-6(7)11-4/h3H,2H2,1H3
InChI key:IZIJOEOJKFKHQR-UHFFFAOYSA-N
SMILES:CCOC(=O)c1cnc(Cl)s1
Synonyms:
  • Ethyl 2-chloro-5-thiazolecarboxylate
  • Ethyl 2-Chloro-1,3-Thiazole-5-Carboxylate
Found 4 products.