CymitQuimica logo

CAS 81449-94-7

:

2-Phenoxy-5-thiazolecarboxaldehyde

Description:
2-Phenoxy-5-thiazolecarboxaldehyde is an organic compound characterized by its unique structure, which includes a phenoxy group and a thiazole ring with an aldehyde functional group. This compound typically appears as a pale yellow to light brown solid or liquid, depending on its purity and specific conditions. It is known for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its biological activity and ability to act as a building block in organic synthesis. The presence of the thiazole ring contributes to its reactivity, particularly in nucleophilic addition reactions, while the aldehyde group can participate in condensation reactions. Additionally, 2-Phenoxy-5-thiazolecarboxaldehyde may exhibit specific solubility characteristics, often being soluble in organic solvents but less so in water. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.
Formula:C10H7NO2S
InChI:InChI=1S/C10H7NO2S/c12-7-9-6-11-10(14-9)13-8-4-2-1-3-5-8/h1-7H
InChI key:InChIKey=BMXGMWGLALFECH-UHFFFAOYSA-N
SMILES:O(C=1SC(C=O)=CN1)C2=CC=CC=C2
Synonyms:
  • 5-Thiazolecarboxaldehyde, 2-phenoxy-
  • 2-Phenoxy-5-thiazolecarboxaldehyde
  • 2-Phenoxy-1,3-thiazole-5-carbaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.