
CAS 81461-73-6
:8-Aza-5-azoniaspiro[4.5]decane, 8-(2-pyrimidinyl)-, bromide (1:1)
Description:
8-Aza-5-azoniaspiro[4.5]decane, 8-(2-pyrimidinyl)-, bromide (1:1) is a quaternary ammonium compound characterized by its unique spirocyclic structure, which incorporates both a nitrogen atom in the spiro framework and a pyrimidine moiety. This compound typically exhibits properties associated with quaternary ammonium salts, such as high solubility in polar solvents and potential antimicrobial activity. The presence of the bromide ion suggests it may function as a counterion, influencing its solubility and reactivity. The pyrimidine ring can contribute to biological activity, making this compound of interest in medicinal chemistry and drug design. Additionally, the spiro structure may impart rigidity, affecting the compound's conformational properties and interactions with biological targets. Overall, 8-Aza-5-azoniaspiro[4.5]decane, 8-(2-pyrimidinyl)-, bromide (1:1) is notable for its structural complexity and potential applications in pharmacology and material science.
Formula:C12H19N4·Br
InChI:InChI=1S/C12H19N4.BrH/c1-2-9-16(8-1)10-6-15(7-11-16)12-13-4-3-5-14-12;/h3-5H,1-2,6-11H2;1H/q+1;/p-1
InChI key:InChIKey=OYIPPQBBPVTVTR-UHFFFAOYSA-M
SMILES:[N+]12(CCN(CC1)C=3N=CC=CN3)CCCC2.[Br-]
Synonyms:- 8-(Pyrimidin-2-yl)-5,8-diazaspiro[4.5]decan-5-ium bromide
- 8-Aza-5-azoniaspiro[4.5]decane, 8-(2-pyrimidinyl)-, bromide (1:1)
- 8-(2-Pyrimidinyl)-8-aza-5-azoniaspiro[4.5]decane bromide
- 8-Aza-5-azoniaspiro[4.5]decane, 8-(2-pyrimidinyl)-, bromide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
8-(Pyrimidin-2-yl)-5,8-diazaspiro[4.5]decan-5-ium bromide
CAS:8-(Pyrimidin-2-yl)-5,8-diazaspiro[4.5]decan-5-ium bromidePurity:98%Molecular weight:299.22g/molBuspirone EP Impurity B (as Bromide)
CAS:Controlled ProductFormula:C12H19N4·BrColor and Shape:NeatMolecular weight:299.228-(2-Pyrimidinyl)-8-aza-5-azoniaspiro[4.5]decane Bromide
CAS:Controlled ProductFormula:C12H19N4·BrColor and Shape:NeatMolecular weight:299.228-(2-Pyrimidinyl)-8-aza-5-azoniaspiro[4.5]decane bromide
CAS:8-(2-Pyrimidinyl)-8-aza-5-azoniaspiro[4.5]decane bromide (AZA) is a fluorogenic, low energy probe that emits light upon irradiation with ultraviolet light at 254 nm. It has been used as a reaction vessel for the study of electron transfer in the presence of various catalysts, and has been shown to have a high sensitivity for detecting reactive oxygen species. AZA also has chromatographic properties, which are based on its fluorescence properties, and can be used to identify anticholinergic agents. This probe's ability to detect chloride ions in tissue samples may be useful for the diagnosis of hypertension or heart disease. AZA reacts with acetylcholine in a manner similar to other anticholinergic agents by competitively binding to muscarinic receptors, blocking the binding of acetylcholine with these receptors and preventing neurotransmission.Formula:C12H19BrN4Purity:Min. 95%Molecular weight:299.21 g/mol




