CymitQuimica logo

CAS 81465-82-9

:

3-(4-fluorophenyl)-1,2-oxazol-5-amine

Description:
3-(4-Fluorophenyl)-1,2-oxazol-5-amine, with the CAS number 81465-82-9, is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. The presence of a 4-fluorophenyl group indicates that there is a fluorine atom attached to a phenyl ring at the para position, which can influence the compound's electronic properties and reactivity. This compound is typically classified as an amine due to the presence of an amino group (-NH2) attached to the oxazole ring. Its unique structure may confer specific biological activities, making it of interest in medicinal chemistry and drug development. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. Additionally, its fluorinated phenyl group may enhance lipophilicity, potentially affecting its pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and pharmaceutical applications.
Formula:C9H7FN2O
InChI:InChI=1/C9H7FN2O/c10-7-3-1-6(2-4-7)8-5-9(11)13-12-8/h1-5H,11H2
InChI key:UUIDVOMRKXGYHN-UHFFFAOYSA-N
SMILES:c1cc(ccc1c1cc(N)on1)F
Synonyms:
  • 5-Isoxazolamine, 3-(4-fluorophenyl)-
Found 5 products.