CymitQuimica logo

CAS 81486-02-4

:

1-(1,1-dioxidotetrahydrothiophen-2-yl)-5-fluoropyrimidine-2,4(1H,3H)-dione

Description:
1-(1,1-Dioxidotetrahydrothiophen-2-yl)-5-fluoropyrimidine-2,4(1H,3H)-dione, with the CAS number 81486-02-4, is a chemical compound that features a pyrimidine core substituted with a fluorine atom and a tetrahydrothiophene moiety. This compound is characterized by its unique structure, which includes a dioxo group and a fluorinated pyrimidine, contributing to its potential biological activity. The presence of the tetrahydrothiophene ring may enhance its solubility and stability in various environments. Typically, compounds of this nature are investigated for their pharmacological properties, particularly in the fields of medicinal chemistry and drug development. The fluorine substitution can influence the compound's electronic properties, potentially affecting its reactivity and interaction with biological targets. Additionally, the dioxo functionality may play a role in the compound's ability to form hydrogen bonds, which is crucial for its biological activity. Overall, this compound represents a class of heterocyclic compounds that may have applications in therapeutic contexts, although specific biological activities would require further investigation.
Formula:C8H9FN2O4S
InChI:InChI=1/C8H9FN2O4S/c9-5-4-11(8(13)10-7(5)12)6-2-1-3-16(6,14)15/h4,6H,1-3H2,(H,10,12,13)
SMILES:C1CC(n2cc(c(nc2=O)O)F)S(=O)(=O)C1
Synonyms:
  • 2,4(1H,3H)-pyrimidinedione, 5-fluoro-1-(tetrahydro-1,1-dioxido-2-thienyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.