CAS 81487-28-7

2′-Cytidylic acid, sodium salt (1:2)

Description:

2′-Cytidylic acid, sodium salt (1:2), also known as sodium cytidylate, is a nucleotide that plays a crucial role in cellular metabolism and the synthesis of RNA. It is characterized by its structure, which includes a pyrimidine base (cytosine), a ribose sugar, and a phosphate group. The sodium salt form indicates that the phosphate group is ionically bonded to sodium ions, enhancing its solubility in aqueous solutions. This compound is typically used in biochemical research and applications, particularly in studies involving nucleic acids and protein synthesis. It is also involved in various metabolic pathways, serving as a building block for RNA synthesis. The presence of the sodium ion can influence the stability and reactivity of the molecule in biological systems. As a salt, it is generally more stable and easier to handle than its acid form. Overall, 2′-Cytidylic acid, sodium salt is essential for understanding nucleic acid chemistry and its applications in molecular biology.

Formula: C₉H₁₄N₃NaO₉P

InChI: InChI=1S/C9H14N3O8P.2Na/c10-5-1-2-12(9(15)11-5)8-7(20-21(16,17)18)6(14)4(3-13)19-8;;/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18);;/t4-,6-,7-,8-;;/m1../s1

InChI key: InChIKey=YKCNSKRDYNCZJC-WFIJOQBCSA-N

SMILES: O(P(=O)(O)O)[C@H]1[C@@H](O[C@H](CO)[C@H]1O)N2C(=O)N=C(N)C=C2.[Na]

Synonyms:

• 2'-Cytidylic acid, disodium salt
• 2′-Cytidylic acid, sodium salt (1:2)

Cytidine-2'-monophosphate sodium

CAS: 81487-28-7

Cytidine-2'-monophosphate sodium (CMP) is a nucleotide that is used as a monophosphate or diphosphate. It can be used to synthesize DNA and RNA. CMP also has antiviral, anticancer, and high purity properties. CMP is an activator of DNA polymerases and helps in the synthesis of DNA. It has novel properties that make it different from other nucleotides, such as its modified sugar moiety.

Formula: C₉H₁₂Na₂N₃O₈P

Purity: Min. 90%

Color and Shape: Powder

Molecular weight: 367.18 g/mol

Ref: 3D-NC13474

Cytidine 2'-monophosphate, sodium salt

CAS: 81487-28-7

Please enquire for more information about Cytidine 2'-monophosphate, sodium salt including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₁₄N₃Na₂O₈P

Molecular weight: 369.18 g/mol

Ref: 3D-C-9900

Cytidine 2′-Monophosphate Disodium Salt

Controlled Product

CAS: 81487-28-7

Formula: C₉H₁₄N₃O₈P·2Na

Color and Shape: Neat

Molecular weight: 323.197

Ref: TR-C424930