CAS 814918-95-1

5-bromo-4-chloro-thieno[2,3-d]pyrimidine

Description:

5-Bromo-4-chloro-thieno[2,3-d]pyrimidine is a heterocyclic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. This compound features bromine and chlorine substituents, which can influence its reactivity and solubility. The presence of these halogens often enhances the compound's biological activity, making it of interest in pharmaceutical research. The thieno[2,3-d]pyrimidine structure is known for its potential applications in medicinal chemistry, particularly in the development of anti-cancer and anti-inflammatory agents. Additionally, the compound's molecular structure allows for various functionalization possibilities, which can be explored to modify its properties further. Its stability and reactivity can be affected by the electronic effects of the halogen substituents, making it a valuable compound for synthetic chemistry. Overall, 5-bromo-4-chloro-thieno[2,3-d]pyrimidine is a versatile compound with significant implications in drug discovery and development.

Formula: C₆H₂BrClN₂S

InChI: InChI=1/C6H2BrClN2S/c7-3-1-11-6-4(3)5(8)9-2-10-6/h1-2H

SMILES: c1c(c2c(Cl)ncnc2s1)Br

Synonyms:

• 5-Bromo-4-chlorothieno[2,3-d]pyrimidine
• Thieno[2,3-D]Pyrimidine, 5-Bromo-4-Chloro-

5-Bromo-4-chlorothieno[2,3-d]pyrimidine

CAS: 814918-95-1

Formula: C₆H₂BrClN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 249.5155

Ref: IN-DA003635

5-Bromo-4-chlorothieno[2,3-d]pyrimidine

CAS: 814918-95-1

5-Bromo-4-chlorothieno[2,3-d]pyrimidine

Purity: 97%

Molecular weight: 249.52g/mol

Ref: 54-OR76609

5-Bromo-4-chlorothieno[2,3-d]pyrimidine

CAS: 814918-95-1

Formula: C₆H₂BrClN₂S

Purity: 97%

Color and Shape: Solid

Molecular weight: 249.51

Ref: 10-F092358