CAS 81493-98-3
:arg-arg-leu-ile-glu-asp-asn-glu-tyr-*thr-ala-arg-
Description:
The chemical substance with the name "arg-arg-leu-ile-glu-asp-asn-glu-tyr-thr-ala-arg-" and CAS number "81493-98-3" is a synthetic peptide composed of a sequence of amino acids. This peptide features a combination of basic, acidic, and neutral amino acids, which contributes to its unique properties and potential biological activities. The presence of arginine (arg) and glutamic acid (glu) suggests that the peptide may have a positive charge at physiological pH, influencing its interaction with biological membranes and proteins. The sequence also includes hydrophobic amino acids like leucine (leu) and isoleucine (ile), which can affect the peptide's conformation and stability. Peptides like this one are often studied for their roles in signaling, enzyme activity, and potential therapeutic applications. Additionally, the specific arrangement of amino acids can lead to unique structural features, impacting the peptide's function in biological systems. Overall, this peptide exemplifies the complexity and diversity of peptide chemistry in biological contexts.
Formula:C66H109N23O23
InChI:InChI=1/C66H109N23O23/c1-7-31(4)50(88-60(109)41(25-30(2)3)84-55(104)38(13-10-24-77-66(73)74)81-53(102)36(67)11-8-22-75-64(69)70)62(111)83-40(19-21-47(95)96)57(106)87-44(28-48(97)98)59(108)86-43(27-45(68)92)58(107)82-39(18-20-46(93)94)56(105)85-42(26-34-14-16-35(91)17-15-34)61(110)89-51(33(6)90)63(112)79-32(5)52(101)80-37(12-9-23-76-65(71)72)54(103)78-29-49(99)100/h14-17,30-33,36-44,50-51,90-91H,7-13,18-29,67H2,1-6H3,(H2,68,92)(H,78,103)(H,79,112)(H,80,101)(H,81,102)(H,82,107)(H,83,111)(H,84,104)(H,85,105)(H,86,108)(H,87,106)(H,88,109)(H,89,110)(H,93,94)(H,95,96)(H,97,98)(H,99,100)(H4,69,70,75)(H4,71,72,76)(H4,73,74,77)
SMILES:CCC(C)C(C(=NC(CCC(=O)O)C(=NC(CC(=O)O)C(=NC(CC(=N)O)C(=NC(CCC(=O)O)C(=NC(Cc1ccc(cc1)O)C(=NC(C(C)O)C(=NC(C)C(=NC(CCCNC(=N)N)C(=NCC(=O)O)O)O)O)O)O)O)O)O)O)N=C(C(CC(C)C)N=C(C(CCCNC(=N)N)N=C(C(CCCNC(=N)N)N)O)O)O
Synonyms:- H-Arg-Arg-Leu-Ile-Glu-Asp-Asn-Glu-Tyr-Thr-Ala-Arg-Gly-OH
- Arginylarginylleucylisoleucyl-Α-Glutamyl-Α-Aspartylasparaginyl-Α-Glutamyltyrosylthreonylalanylarginylglycine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
H-Arg-Arg-Leu-Ile-Glu-Asp-Asn-Glu-Tyr-Thr-Ala-Arg-Gly-OH
CAS:<p>H-Arg-Arg-Leu-Ile-Glu-Asp-Asn-Glu-Tyr-Thr-Ala-Arg-Gly-OH is a synthetic peptide that has been shown to have a homologous sequence with the amino acid sequence of a primary tumor. This peptide has strong binding affinity to tyrosine kinase, which is an enzyme involved in cellular signal transduction. H-Arg-Arg-Leu-Ile-Glu-Asp-Asn Glu Tyr Thr Ala Arg Gly OH has been shown to inhibit the growth of tumors and can be used as an analytical method for identifying carcinoma cells in vitro. HAAGLTEIGDATASNTTAHARGLTRALAGRGGYOH is also a potential drug for cardiovascular diseases, as it can be taken up intracellularly and may inhibit the proliferation of vascular smooth muscle cells.</p>Formula:C66H109N23O23Purity:Min. 95%Molecular weight:1,592.71 g/mol
