CAS 81495-76-3

2,3-Butanediol, 2,3-dimethanesulfonate, (2R,3R)-

Description:

2,3-Butanediol, 2,3-dimethanesulfonate, (2R,3R)- is a chemical compound characterized by its specific stereochemistry and functional groups. It features a butanediol backbone, which consists of a four-carbon chain with hydroxyl (-OH) groups at the second and third carbon positions. The dimethanesulfonate moiety indicates the presence of two methanesulfonate groups, which are sulfonic acid derivatives that enhance the compound's solubility and reactivity. This compound is typically a colorless to pale yellow liquid and is soluble in water and various organic solvents due to its polar functional groups. It is often used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or other chemical products. The (2R,3R) designation refers to the specific stereochemistry of the molecule, indicating the spatial arrangement of the substituents around the chiral centers, which can significantly influence its biological activity and reactivity. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₆H₁₄O₆S₂

InChI: InChI=1S/C6H14O6S2/c1-5(11-13(3,7)8)6(2)12-14(4,9)10/h5-6H,1-4H3/t5-,6-/m1/s1

InChI key: InChIKey=WRAXODRAAIYKAW-PHDIDXHHSA-N

SMILES: O([C@@H]([C@H](OS(C)(=O)=O)C)C)S(C)(=O)=O

Synonyms:

• 2,3-Butanediol, 2,3-dimethanesulfonate, (2R,3R)-
• 2,3-Butanediol, dimethanesulfonate, (2R,3R)-

(2R,3R)-Butanediol bis(methanesulfonate)

CAS: 81495-76-3

(2R,3R)-Butanediol bis(methanesulfonate)

Molecular weight: 246.30g/mol

Ref: 54-OR322258