CAS 815-68-9
:3-Acetyl-2,4-pentanedione
Description:
3-Acetyl-2,4-pentanedione, also known by its CAS number 815-68-9, is an organic compound characterized by its diketone structure. It features two carbonyl groups (C=O) flanked by a central carbon chain, specifically a five-carbon backbone. This compound is typically a colorless to pale yellow liquid with a sweet, pleasant odor. It is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic nature. 3-Acetyl-2,4-pentanedione is known for its ability to chelate metal ions, making it useful in various applications, including as a reagent in organic synthesis and in the production of coordination compounds. Additionally, it can serve as a flavoring agent and is sometimes used in the formulation of fragrances. The compound exhibits reactivity typical of diketones, including enolization, which can lead to the formation of various derivatives. Safety precautions should be observed when handling this substance, as it may pose health risks upon exposure.
Formula:C7H10O3
InChI:InChI=1S/C7H10O3/c1-4(8)7(5(2)9)6(3)10/h7H,1-3H3
InChI key:InChIKey=AUZFRUHVDNDVJI-UHFFFAOYSA-N
SMILES:C(C(C)=O)(C(C)=O)C(C)=O
Synonyms:- 2,4-Pentanedione, 3-acetyl-
- 3-(1-Hydroxyethylidene)Pentane-2,4-Dione
- 3-Acetyl-2,4-pentanedione
- 3-Acetylpentane-2,4-Dione
- Methine Triacetate
- NSC 52979
- Triacetylmethane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
