CAS 81502-74-1

2-hydroxybenzene-1,3,5-tricarbaldehyde

Description:

2-Hydroxybenzene-1,3,5-tricarbaldehyde, also known as gallic aldehyde, is an organic compound characterized by its three aldehyde functional groups attached to a benzene ring, along with a hydroxyl group. This compound is typically a white to light yellow solid at room temperature and is soluble in organic solvents. Its molecular structure allows for various chemical reactivity, particularly in condensation reactions and as a potential precursor in the synthesis of more complex organic molecules. The presence of multiple aldehyde groups makes it a versatile building block in organic synthesis, particularly in the development of dyes, pharmaceuticals, and agrochemicals. Additionally, the hydroxyl group contributes to its potential antioxidant properties. The compound's reactivity can be influenced by the presence of substituents on the benzene ring, which can affect its electronic properties and steric hindrance. Overall, 2-hydroxybenzene-1,3,5-tricarbaldehyde is of interest in both academic research and industrial applications due to its unique structural features and reactivity.

Formula: C₉H₆O₄

InChI: InChI=1/C9H6O4/c10-3-6-1-7(4-11)9(13)8(2-6)5-12/h1-5,13H

SMILES: c1c(cc(C=O)c(c1C=O)O)C=O

Synonyms:

• 2-Hydroxy-1,3,5-Benzenetricarbaldehyde

2-Hydroxy-1,3,5-benzenetricarbaldehyde

CAS: 81502-74-1

Formula: C₉H₆O₄

Purity: >98.0%(GC)(T)

Color and Shape: White to Yellow powder to crystal

Molecular weight: 178.14

Ref: 3B-H1651

1,3,5-Benzenetricarboxaldehyde,2-hydroxy-

CAS: 81502-74-1

Formula: C₉H₆O₄

Purity: 97%

Color and Shape: Solid

Molecular weight: 178.1415

Ref: IN-DA005910

2-Hydroxybenzene-1,3,5-tricarboxaldehyde

CAS: 81502-74-1

2-Hydroxybenzene-1,3,5-tricarboxaldehyde

Formula: C₉H₆O₄

Purity: 95%

Color and Shape: yellow to faint orange solid

Molecular weight: 178.14g/mol

Ref: 54-OR27683

2-Hydroxybenzene-1,3,5-tricarbaldehyde

CAS: 81502-74-1

Purity: 97%

Color and Shape: Solid

Molecular weight: 178.1430054

Ref: 10-F603182