CAS 81502-74-1: 2-hydroxybenzene-1,3,5-tricarbaldehyde

Description:2-Hydroxybenzene-1,3,5-tricarbaldehyde, also known as gallic aldehyde, is an organic compound characterized by its three aldehyde functional groups attached to a benzene ring, along with a hydroxyl group. This compound is typically a white to light yellow solid at room temperature and is soluble in organic solvents. Its molecular structure allows for various chemical reactivity, particularly in condensation reactions and as a potential precursor in the synthesis of more complex organic molecules. The presence of multiple aldehyde groups makes it a versatile building block in organic synthesis, particularly in the development of dyes, pharmaceuticals, and agrochemicals. Additionally, the hydroxyl group contributes to its potential antioxidant properties. The compound's reactivity can be influenced by the presence of substituents on the benzene ring, which can affect its electronic properties and steric hindrance. Overall, 2-hydroxybenzene-1,3,5-tricarbaldehyde is of interest in both academic research and industrial applications due to its unique structural features and reactivity.

Formula:C₉H₆O₄

InChI:InChI=1/C9H6O4/c10-3-6-1-7(4-11)9(13)8(2-6)5-12/h1-5,13H

Synonyms:
2-Hydroxy-1,3,5-Benzenetricarbaldehyde

Found 5 products.

Product data	Purity	Price range	Estimated delivery
2-Hydroxy-1,3,5-benzenetricarbaldehyde REF: 3B-H1651CAS: 81502-74-1	>98.0%(GC)(T)	153.00 €	Tue 05 Aug 25
1,3,5-Benzenetricarboxaldehyde,2-hydroxy- REF: IN-DA005910CAS: 81502-74-1	95%	35.00 €~559.00 €	Tue 12 Aug 25
2-Hydroxybenzene-1,3,5-tricarboxaldehyde REF: 54-OR27683CAS: 81502-74-1	95%	32.00 €~2,262.00 €	Wed 13 Aug 25
2-Hydroxybenzene-1,3,5-tricarbaldehyde REF: 10-F603182CAS: 81502-74-1	97%	24.00 €~430.00 €	Mon 18 Aug 25
2-Hydroxy-1,3,5-benzenetricarbaldehyde REF: 3D-FH147437CAS: 81502-74-1	Min. 95%	- - -	Discontinued product