CAS 81525-13-5: Forsythoside B
Description:Forsythoside B is a natural compound primarily derived from the flowers of the Forsythia genus, particularly Forsythia suspensa. It belongs to the class of phenylethanoid glycosides, which are known for their diverse biological activities. Forsythoside B is characterized by its glycosidic structure, consisting of a phenylethanoid moiety linked to a sugar unit, typically glucose. This compound exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and antiviral activities, making it of interest in medicinal chemistry and natural product research. Its potential therapeutic applications are being explored in the context of traditional medicine, particularly in East Asian cultures where Forsythia species are commonly used. Forsythoside B is soluble in polar solvents, and its stability can be influenced by factors such as pH and temperature. As research continues, the understanding of its mechanisms of action and potential health benefits may expand, highlighting the importance of natural compounds in drug discovery and development.
Formula:C34H44O19
InChI:InChI=1S/C34H44O19/c1-15-24(41)25(42)26(43)32(50-15)53-29-27(44)31(47-9-8-17-3-6-19(37)21(39)11-17)51-22(12-48-33-30(45)34(46,13-35)14-49-33)28(29)52-23(40)7-4-16-2-5-18(36)20(38)10-16/h2-7,10-11,15,22,24-33,35-39,41-46H,8-9,12-14H2,1H3/b7-4+/t15-,22+,24-,25+,26+,27+,28+,29+,30-,31+,32-,33+,34+/m0/s1
InChI key:InChIKey=JMBINOWGIHWPJI-UNSOMVRXSA-N
SMILES:O=C(OC1C(OC(OCCC2=CC=C(O)C(O)=C2)C(O)C1OC3OC(C)C(O)C(O)C3O)COC4OCC(O)(CO)C4O)C=CC5=CC=C(O)C(O)=C5
- Synonyms:
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→6)-O-[6-deoxy-α-L-mannopyranosyl-(1→3)]-, 4-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→6)-O-[6-deoxy-α-L-mannopyranosyl-(1→3)]-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- Forsythoside B
