CAS 81525-13-5
:Forsythoside B
Description:
Forsythoside B is a natural compound primarily derived from the flowers of the Forsythia genus, particularly Forsythia suspensa. It belongs to the class of phenylethanoid glycosides, which are known for their diverse biological activities. Forsythoside B is characterized by its glycosidic structure, consisting of a phenylethanoid moiety linked to a sugar unit, typically glucose. This compound exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and antiviral activities, making it of interest in medicinal chemistry and natural product research. Its potential therapeutic applications are being explored in the context of traditional medicine, particularly in East Asian cultures where Forsythia species are commonly used. Forsythoside B is soluble in polar solvents, and its stability can be influenced by factors such as pH and temperature. As research continues, the understanding of its mechanisms of action and potential health benefits may expand, highlighting the importance of natural compounds in drug discovery and development.
Formula:C34H44O19
InChI:InChI=1S/C34H44O19/c1-15-24(41)25(42)26(43)32(50-15)53-29-27(44)31(47-9-8-17-3-6-19(37)21(39)11-17)51-22(12-48-33-30(45)34(46,13-35)14-49-33)28(29)52-23(40)7-4-16-2-5-18(36)20(38)10-16/h2-7,10-11,15,22,24-33,35-39,41-46H,8-9,12-14H2,1H3/b7-4+/t15-,22+,24-,25+,26+,27+,28+,29+,30-,31+,32-,33+,34+/m0/s1
InChI key:InChIKey=JMBINOWGIHWPJI-UNSOMVRXSA-N
SMILES:O(C(/C=C/C1=CC(O)=C(O)C=C1)=O)[C@H]2[C@H](O[C@H]3[C@H](O)[C@H](O)[C@@H](O)[C@H](C)O3)[C@@H](O)[C@H](OCCC4=CC(O)=C(O)C=C4)O[C@@H]2CO[C@H]5[C@H](O)[C@](CO)(O)CO5
Synonyms:- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→6)-O-[6-deoxy-α-L-mannopyranosyl-(1→3)]-, 4-[3-(3,4-dihydroxyphenyl)-2-propenoate], (E)-
- β-D-Glucopyranoside, 2-(3,4-dihydroxyphenyl)ethyl O-D-apio-β-D-furanosyl-(1→6)-O-[6-deoxy-α-L-mannopyranosyl-(1→3)]-, 4-[(2E)-3-(3,4-dihydroxyphenyl)-2-propenoate]
- Forsythoside B
- Forsythoside B, 98%, from Callicarpa kwangtungensis Chun
- (E)-O-D-Apio-beta-D-furanosyl-(1-6)-O-[6-deoxy-alpha-L-mannopyranosyl-(1-3)]-beta-D-glucopyranoside 2-(3,4-dihydroxyphenyl)ethyl 4-[3-(3,4-dihydroxyphenyl)-2-propenoate]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 10 products.
Forsythoside B
CAS:Forsythoside B inhibits inflammatory response, has antioxidant, antisepsis properties, and also has potent neuroprotective effects with a favorable therapeutic time-window, reduce of cerebral ischemia and reperfusion injury degree, attenuating blood-brain barrier (BBB) breakdown. Forsythoside B could inhibit TNF-alpha, IL-6, IκB and modulate NF-κB.Formula:C34H44O19Purity:95%~99%Molecular weight:756.707Forsythoside B
CAS:Forsythoside B inhibits LPS, NF-κB, inflammation, offers neuroprotection, reduces ischemia injury, and has antioxidant and antisepsis effects.Formula:C34H44O19Purity:98% - 99.81%Color and Shape:SolidMolecular weight:756.70Forsythoside b
CAS:Natural glycosideFormula:C34H44O19Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:756.71Forsythoside B
CAS:Forsythoside B is a phenylethanoid glycoside, which is a naturally occurring compound primarily sourced from the Forsythia plant, particularly Forsythia suspensa. This compound is known for its biological activity, including antioxidant and antimicrobial properties. Forsythoside B exerts its effects by scavenging free radicals and inhibiting microbial growth through disruption of cell wall integrity or interference with microbial metabolism.Formula:C34H44O19Purity:Min. 98 Area-%Color and Shape:White Off-White PowderMolecular weight:756.7 g/molForsythoside B
CAS:Controlled ProductStability Hygroscopic
Applications Forsythoside B is an anti-inflammatory agent protecting against such effects such as sepsis. Neuroprotective agent.
References Jiang, W. et al.: Phytother. Res., 26, 981 (2012); Jiang, W. et al.: Neuropharmacol. Analges., 640, 75 (2010);Formula:C34H44O19Color and Shape:NeatMolecular weight:756.7








