CAS 81528-80-5

1-Phenoxy-3-[[2-[(1,3,5-trimethyl-1H-pyrazol-4-yl)amino]ethyl]amino]-2-propanol

Description:

1-Phenoxy-3-[[2-[(1,3,5-trimethyl-1H-pyrazol-4-yl)amino]ethyl]amino]-2-propanol, with CAS number 81528-80-5, is a chemical compound characterized by its complex structure that includes a phenoxy group and a pyrazole moiety. This compound typically exhibits properties such as being a solid or liquid at room temperature, depending on its specific formulation and purity. It is likely to be soluble in organic solvents due to the presence of hydrophobic groups, while its polar functional groups may impart some degree of hydrophilicity. The presence of amino groups suggests potential for hydrogen bonding, which can influence its reactivity and interaction with biological systems. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting specific biological pathways. Its unique structural features could contribute to its biological activity, making it a candidate for further investigation in medicinal chemistry. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper laboratory practices.

Formula: C₁₇H₂₆N₄O₂

InChI: InChI=1S/C17H26N4O2/c1-13-17(14(2)21(3)20-13)19-10-9-18-11-15(22)12-23-16-7-5-4-6-8-16/h4-8,15,18-19,22H,9-12H2,1-3H3

InChI key: InChIKey=CRKZWPJRHFAGCJ-UHFFFAOYSA-N

SMILES: N(CCNCC(COC1=CC=CC=C1)O)C=2C(C)=NN(C)C2C

Synonyms:

• Dalbraminol
• 2-Propanol, 1-phenoxy-3-[[2-[(1,3,5-trimethyl-1H-pyrazol-4-yl)amino]ethyl]amino]-
• 1-Phenoxy-3-[[2-[(1,3,5-trimethyl-1H-pyrazol-4-yl)amino]ethyl]amino]-2-propanol

Dalbraminol

CAS: 81528-80-5

Dalbraminol is a beta blocker.

Formula: C₁₇H₂₆N₄O₂

Color and Shape: Solid

Molecular weight: 318.41

Ref: TM-T68646