CAS 81532-77-6

5,6,7,8-Tetrahydro-2(1H)-quinazolinone

Description:

5,6,7,8-Tetrahydro-2(1H)-quinazolinone is a bicyclic organic compound characterized by its fused quinazolinone structure, which consists of a quinazoline ring system with a saturated tetrahydro moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. It is known for its potential biological activities, including antimicrobial and anti-inflammatory properties, making it of interest in medicinal chemistry. The presence of the carbonyl and nitrogen functionalities in its structure contributes to its reactivity and ability to form hydrogen bonds, which can influence its interaction with biological targets. Additionally, the compound's molecular structure allows for various synthetic modifications, enhancing its utility in drug development. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact may vary. Overall, 5,6,7,8-Tetrahydro-2(1H)-quinazolinone represents a significant scaffold in the exploration of new therapeutic agents.

Formula: C₈H₁₀N₂O

InChI: InChI=1S/C8H10N2O/c11-8-9-5-6-3-1-2-4-7(6)10-8/h5H,1-4H2,(H,9,10,11)

InChI key: InChIKey=DBXATJCVRRXUTC-UHFFFAOYSA-N

SMILES: O=C1NC2=C(C=N1)CCCC2

Synonyms:

• 1,2,5,6,7,8-Hexahydroquinazolin-2-one
• 2(1H)-Quinazolinone, 5,6,7,8-tetrahydro-
• 5,6,7,8-Tetrahydro-2(1H)-quinazolinone

1,2,5,6,7,8-Hexahydroquinazolin-2-one

CAS: 81532-77-6

Quinazolone is an organic compound that can be classified as a hydrocarbon, aliphatic hydrocarbon, or a radical. It has been used in the production of benzyl, growth regulators and biocides. Quinazolone is also used for plant growth and is effective against some fungi such as Penicillium notatum.

Formula: C₈H₁₀N₂O

Purity: Min. 95%

Molecular weight: 150.18 g/mol

Ref: 3D-GDA53277