CAS 81542-52-1
:4-Iodo-5-methyl-1H-pyrazol-3-amine
Description:
4-Iodo-5-methyl-1H-pyrazol-3-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of an iodine atom at the 4-position and a methyl group at the 5-position of the pyrazole ring contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. It is often used in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. The iodine substituent can also enhance the compound's reactivity in various chemical reactions, such as nucleophilic substitutions or coupling reactions. Safety precautions should be taken when handling this compound, as it may pose health risks, and proper storage conditions should be observed to maintain its stability. Overall, 4-Iodo-5-methyl-1H-pyrazol-3-amine is a valuable compound in organic synthesis and medicinal chemistry.
Formula:C4H6IN3
InChI:InChI=1S/C4H6IN3/c1-2-3(5)4(6)8-7-2/h1H3,(H3,6,7,8)
InChI key:InChIKey=FXVKMQDLYRBZPP-UHFFFAOYSA-N
SMILES:IC1=C(C)NN=C1N
Synonyms:- 1H-Pyrazol-3-amine, 4-iodo-5-methyl-
- 4-Iodo-5-methyl-1H-pyrazol-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
