CAS 81545-42-8
:3-({3,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(5E)-1-methyl-9-(methylcarbamimidamido)non-5-en-1-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-5-yl}oxy)-3-oxopropanoic acid
Description:
The chemical substance known as "3-({3,7,9,23,25,27,31,33,34,35-decahydroxy-10,14,18,22,26,30-hexamethyl-15-[(5E)-1-methyl-9-(methylcarbamimidamido)non-5-en-1-yl]-17-oxo-16,37-dioxabicyclo[31.3.1]heptatriaconta-10,12,18,20-tetraen-5-yl}oxy)-3-oxopropanoic acid" (CAS 81545-42-8) is a complex organic compound characterized by its intricate structure, which includes multiple hydroxyl groups, a bicyclic framework, and various functional groups such as oxo and carbamimidamido moieties. This compound exhibits significant molecular complexity, suggesting potential biological activity or utility in medicinal chemistry. The presence of multiple hydroxy groups indicates high polarity, which may influence its solubility and reactivity. Additionally, the presence of a long carbon chain and various substituents may contribute to its lipophilicity and potential interactions with biological membranes. Overall, this compound's unique structural features may render it of interest for further research in fields such as pharmacology or materials science, although specific applications would require additional investigation.
Formula:C56H95N3O17
InChI:InChI=1/C56H95N3O17/c1-33-18-15-20-37(5)52(36(4)17-13-11-9-10-12-14-24-59-55(57)58-8)75-54(72)38(6)21-16-19-34(2)46(64)30-47(65)39(7)44(62)23-22-35(3)49(67)32-56(73)53(71)48(66)29-43(76-56)27-40(60)25-42(26-41(61)28-45(33)63)74-51(70)31-50(68)69/h9-10,15-16,18-21,34-37,39-49,52-53,60-67,71,73H,11-14,17,22-32H2,1-8H3,(H,68,69)(H3,57,58,59)/b10-9+,19-16u,20-15u,33-18u,38-21u
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.