CAS 81548-04-1
:1H-Tetrazole-1-acetic acid, hydrazide
Description:
1H-Tetrazole-1-acetic acid, hydrazide is a chemical compound characterized by its tetrazole ring structure, which is a five-membered aromatic ring containing four nitrogen atoms and one carbon atom. This compound features an acetic acid moiety and a hydrazide functional group, contributing to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the tetrazole ring imparts unique properties, such as the ability to form coordination complexes and exhibit biological activity. Additionally, the hydrazide group can participate in various chemical reactions, including hydrazone formation and coupling reactions. The compound is typically synthesized through specific organic reactions involving tetrazole derivatives and hydrazine or its derivatives. Its solubility and stability can vary depending on the solvent and environmental conditions. Overall, 1H-Tetrazole-1-acetic acid, hydrazide is of interest for its potential applications in medicinal chemistry and as a building block for more complex molecules.
Formula:C3H6N6O
InChI:InChI=1S/C3H6N6O/c4-6-3(10)1-9-2-5-7-8-9/h2H,1,4H2,(H,6,10)
InChI key:InChIKey=YDORFIZIPBBRKA-UHFFFAOYSA-N
SMILES:C(C(NN)=O)N1C=NN=N1
Synonyms:- 2-(Tetrazol-1-yl)acetohydrazide
- 2-(1H-1,2,3,4-Tetrazol-1-yl)acetohydrazide
- Tetrazolyl-1-acetohydrazide
- 1H-Tetrazole-1-acetic acid, hydrazide
- 2-(1H-Tetrazol-1-yl)acetohydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.