CAS 815580-04-2
:6-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]
Description:
6-Bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] is a chemical compound characterized by its unique spirocyclic structure, which consists of a benzodioxine moiety fused to a piperidine ring. The presence of a bromine atom at the 6-position of the benzodioxine enhances its reactivity and may influence its biological activity. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and varying stability under different conditions. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the benzodioxine and piperidine functionalities, which are often associated with diverse biological activities. Additionally, the compound may undergo various chemical reactions, such as electrophilic substitutions or nucleophilic attacks, owing to the functional groups present. Overall, 6-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] represents a complex and potentially bioactive molecule of interest in chemical research.
Formula:C12H14BrNO2
InChI:InChI=1/C12H14BrNO2/c13-10-1-2-11-9(7-10)8-15-12(16-11)3-5-14-6-4-12/h1-2,7,14H,3-6,8H2
Synonyms:- 6-Bromo-4H-spiro[1,3-benzodioxine-2,4'-piperidine]
- spiro[4H-1,3-benzodioxin-2,4'-piperidine], 6-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-BroMo-4H-spiro[benzo[d][1,3]dioxine-2,4'-piperidine]
CAS:Formula:C12H14BrNO2Molecular weight:284.1491

