CAS 81560-33-0

4-[2-(Dimethylamino)ethoxy]-1,2-benzenedicarbonitrile

Description:

4-[2-(Dimethylamino)ethoxy]-1,2-benzenedicarbonitrile, with the CAS number 81560-33-0, is an organic compound characterized by its complex structure, which includes a benzene ring substituted with two cyano groups and an ethoxy group linked to a dimethylamino moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in various fields, including pharmaceuticals and materials science. The presence of the dimethylamino group suggests it may exhibit basic properties, while the cyano groups can impart significant reactivity and polarity. Additionally, the ethoxy group can enhance solubility in organic solvents. The compound's molecular interactions may be influenced by hydrogen bonding and dipole-dipole interactions due to its functional groups. Overall, this substance is of interest for its potential utility in synthetic chemistry and as a building block for more complex molecules. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₂H₁₃N₃O

InChI: InChI=1S/C12H13N3O/c1-15(2)5-6-16-12-4-3-10(8-13)11(7-12)9-14/h3-4,7H,5-6H2,1-2H3

InChI key: InChIKey=HPODFACZIGFMJV-UHFFFAOYSA-N

SMILES: C(#N)C1=C(C#N)C=C(OCCN(C)C)C=C1

Synonyms:

• 1,2-Dicyano-4-[2-N,N-dimethylamino)ethoxy]benzene
• 4-(2-Dimethylaminoethoxy)phthalodinitrile
• 4-[2-(Dimethylamino)ethoxy]-1,2-benzenedicarbonitrile
• 1,2-Benzenedicarbonitrile, 4-[2-(dimethylamino)ethoxy]-