CymitQuimica logo

CAS 815619-82-0

:

Phenylalanine, 5-borono-2-methoxy-

Description:
Phenylalanine, 5-borono-2-methoxy- is an organic compound characterized by the presence of a boronic acid functional group and a methoxy substituent on a phenylalanine backbone. This compound typically exhibits properties associated with both amino acids and boron-containing compounds, making it useful in various biochemical applications. The boron atom in the structure can form reversible covalent bonds with diols, which is significant in biochemical sensing and drug delivery systems. The methoxy group contributes to the compound's hydrophobic character, influencing its solubility and interaction with biological membranes. Additionally, phenylalanine is an essential amino acid, playing a crucial role in protein synthesis and serving as a precursor for neurotransmitters. The specific arrangement of substituents in this compound can affect its reactivity and biological activity, making it a subject of interest in medicinal chemistry and materials science. Overall, Phenylalanine, 5-borono-2-methoxy- combines features of both amino acids and boron chemistry, offering potential for innovative applications in research and industry.
Formula:C10H14BNO5
InChI:InChI=1S/C10H14BNO5/c1-17-9-3-2-7(11(15)16)4-6(9)5-8(12)10(13)14/h2-4,8,15-16H,5,12H2,1H3,(H,13,14)
InChI key:InChIKey=FMYAMYZMXPWMEF-UHFFFAOYSA-N
SMILES:C(C(C(O)=O)N)C1=C(OC)C=CC(B(O)O)=C1
Synonyms:
  • Phenylalanine, 5-borono-2-methoxy-
  • 2-Amino-3-(5-dihydroxyboryl-2-methoxyphenyl)propionic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.