CymitQuimica logo

CAS 815631-56-2

:

2-(4-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane

Description:
2-(4-Fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is an organoboron compound characterized by its unique dioxaborolane structure, which features a five-membered ring containing boron and oxygen atoms. This compound typically exhibits a high degree of stability due to the presence of the boron atom, which can participate in various chemical reactions, including cross-coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The presence of the 4-fluoro-2-methylphenyl group enhances its lipophilicity and may influence its biological activity. Additionally, the tetramethyl substituents contribute to steric hindrance, which can affect reactivity and solubility. This compound is often utilized in the development of pharmaceuticals and agrochemicals, as well as in materials science for the synthesis of boron-containing polymers. Its specific properties, such as melting point, boiling point, and solubility, would depend on the conditions under which it is studied, but it is generally handled with standard safety precautions due to the potential reactivity of boron compounds.
Formula:C13H18BFO2
InChI:InChI=1/C13H18BFO2/c1-9-8-10(15)6-7-11(9)14-16-12(2,3)13(4,5)17-14/h6-8H,1-5H3
InChI key:HHWOQSZBVGPYMH-UHFFFAOYSA-N
SMILES:Cc1cc(ccc1B1OC(C)(C)C(C)(C)O1)F
Synonyms:
  • 1,3,2-Dioxaborolane, 2-(4-fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-
  • 2-(4-Fluoro-2-methylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
Found 4 products.