CAS 815650-85-2

1-(Hexahydro-1H-1,4-diazepin-1-yl)-2-phenoxyethanone

Description:

1-(Hexahydro-1H-1,4-diazepin-1-yl)-2-phenoxyethanone, with the CAS number 815650-85-2, is a chemical compound characterized by its unique structure that includes a hexahydro-1H-1,4-diazepine ring and a phenoxyethanone moiety. This compound typically exhibits properties associated with both its cyclic amine and aromatic components, which may influence its solubility, stability, and reactivity. The presence of the diazepine ring suggests potential biological activity, as many compounds containing this structure are known for their pharmacological properties. The phenoxyethanone part of the molecule may contribute to its ability to interact with various biological targets. In terms of physical properties, it may be a solid or liquid at room temperature, depending on its specific formulation and purity. Its applications could span across medicinal chemistry, where it may serve as a lead compound for drug development, or in other fields requiring specific chemical functionalities. However, detailed studies would be necessary to fully elucidate its characteristics and potential uses.

Formula: C₁₃H₁₈N₂O₂

InChI: InChI=1S/C13H18N2O2/c16-13(15-9-4-7-14-8-10-15)11-17-12-5-2-1-3-6-12/h1-3,5-6,14H,4,7-11H2

InChI key: InChIKey=MVYWUEOILJVYOM-UHFFFAOYSA-N

SMILES: C(COC1=CC=CC=C1)(=O)N2CCCNCC2

Synonyms:

• 1H-1,4-Diazepine, hexahydro-1-(phenoxyacetyl)-
• Ethanone, 1-(hexahydro-1H-1,4-diazepin-1-yl)-2-phenoxy-
• 1-(Hexahydro-1H-1,4-diazepin-1-yl)-2-phenoxyethanone