CAS 81568-83-4

{[(2-bromophenyl)carbonyl]amino}acetate

Description:

The chemical substance known as {(2-bromophenyl)carbonyl]amino}acetate, with the CAS number 81568-83-4, is characterized by its unique structural features and functional groups. It contains a brominated phenyl ring, which contributes to its reactivity and potential biological activity. The carbonyl group attached to the phenyl ring indicates the presence of an amide linkage, while the acetate moiety suggests that it can participate in various chemical reactions, such as esterification or amidation. This compound may exhibit polar characteristics due to the presence of both the carbonyl and acetate groups, influencing its solubility in polar solvents. Additionally, the bromine atom can enhance the compound's electrophilic properties, making it a candidate for further chemical transformations. The presence of the amino group suggests potential for hydrogen bonding, which can affect its interaction with biological systems. Overall, this compound's structural complexity and functional groups make it of interest in synthetic organic chemistry and potentially in medicinal chemistry for its biological properties.

Formula: C₉H₇BrNO₃

InChI: InChI=1/C9H8BrNO3/c10-7-4-2-1-3-6(7)9(14)11-5-8(12)13/h1-4H,5H2,(H,11,14)(H,12,13)/p-1

SMILES: c1ccc(c(c1)C(=NCC(=O)[O-])O)Br

2-[(2-Bromophenyl)formamido]acetic acid

CAS: 81568-83-4

2-[(2-Bromophenyl)formamido]acetic acid is a bile salt that is used to treat liver disease. It is a prodrug of taurocholic acid, which is a naturally occurring bile salt that is essential for the digestion of dietary fats. 2-[(2-Bromophenyl)formamido]acetic acid has been shown to have a constant rate of hydrolysis and can be used as an alternative to taurocholic acid in cases where the latter cannot be metabolized due to genetic defects or enzyme deficiencies. This drug also has the ability to neutralize staphylococcus by converting it into hippuric acid, which can then be excreted from the body via urine. 2-[(2-Bromophenyl)formamido]acetic acid does not undergo any reactions with other drugs, making it ideal for patients who are taking other medications for unrelated conditions.

Formula: C₉H₈BrNO₃

Purity: Min. 95%

Molecular weight: 258.07 g/mol

Ref: 3D-GDA56883