CymitQuimica logo

CAS 81568-85-6

:

2-iodobenzenecarbothioamide

Description:
2-Iodobenzenecarbothioamide is an organic compound characterized by the presence of a benzene ring substituted with an iodine atom and a carbothioamide functional group. Its molecular structure features a thiocarbonyl group (C=S) bonded to an amine (NH2) and is attached to the benzene ring at the second position, indicating its ortho-substitution. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to the hydrophobic nature of the aromatic ring. The presence of the iodine atom can impart unique reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the thiocarbonyl group can participate in diverse chemical transformations, enhancing its utility in synthetic organic chemistry. The compound's properties, such as melting point, boiling point, and reactivity, can vary based on the specific conditions and the presence of other functional groups in a reaction. Overall, 2-iodobenzenecarbothioamide serves as an interesting building block in the synthesis of more complex organic molecules.
Formula:C7H6INS
InChI:InChI=1/C7H6INS/c8-6-4-2-1-3-5(6)7(9)10/h1-4H,(H2,9,10)
SMILES:c1ccc(c(c1)C(=N)S)I
Synonyms:
  • 2-Iodothiobenzamide
  • Benzenecarbothioamide, 2-iodo-
  • Suyzr Bi
  • Thiobenzamide, 2-iodo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.