CAS 81569-45-1
:Methyl 5-ethyl-4-thiazolecarboxylate
Description:
Methyl 5-ethyl-4-thiazolecarboxylate is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. This compound features a carboxylate functional group, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid with a distinctive odor. The presence of the ethyl group enhances its hydrophobic characteristics, while the methyl ester group increases its solubility in organic solvents. Methyl 5-ethyl-4-thiazolecarboxylate is often utilized in the synthesis of various pharmaceuticals and agrochemicals due to its ability to act as an intermediate in chemical reactions. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many thiazole derivatives, it may possess antimicrobial or antifungal properties, although specific biological activities would depend on further empirical studies. Proper handling and safety measures should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C7H9NO2S
InChI:InChI=1S/C7H9NO2S/c1-3-5-6(7(9)10-2)8-4-11-5/h4H,3H2,1-2H3
InChI key:InChIKey=UJWHTPUQSUHEGZ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C(CC)SC=N1
Synonyms:- Methyl 5-ethyl-4-thiazolecarboxylate
- 4-Thiazolecarboxylic acid, 5-ethyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
