
CAS 81576-60-5
:1-Bromodecane-1,1-d2
Description:
1-Bromodecane-1,1-d2 is a deuterated alkyl halide, specifically a brominated derivative of decane. Its molecular formula is C10H21BrD2, indicating the presence of deuterium, a stable isotope of hydrogen, which replaces two hydrogen atoms in the decane chain. This compound is characterized by its long hydrophobic carbon chain, which contributes to its non-polar nature, making it less soluble in water but soluble in organic solvents. The presence of the bromine atom introduces a polar functional group, which can participate in nucleophilic substitution reactions. The deuterium labeling is particularly useful in studies involving reaction mechanisms and kinetics, as it allows for the tracking of molecular behavior in various chemical processes. 1-Bromodecane-1,1-d2 is typically used in organic synthesis and research applications, including the development of pharmaceuticals and in the study of reaction pathways. Safety precautions should be taken when handling this compound, as it may pose health risks similar to other alkyl bromides.
Formula:C10H19BrD2
InChI:InChI=1S/C10H21Br/c1-2-3-4-5-6-7-8-9-10-11/h2-10H2,1H3/i10D2
InChI key:InChIKey=MYMSJFSOOQERIO-KBMKNGFXSA-N
SMILES:C(CCCC(Br)([2H])[2H])CCCCC
Synonyms:- 1-Bromodecane-1,1-d2
- Decane-1,1-d2, 1-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.