CAS 81591-83-5

Oxirane, 2,2′-[[1,1′-biphenyl]-4,4′-diylbis(methylene)]bis-

Description:

Oxirane, 2,2′-[[1,1′-biphenyl]-4,4′-diylbis(methylene)]bis- is a chemical compound characterized by its oxirane (epoxide) functional group, which is a three-membered cyclic ether known for its reactivity and strain. This compound features a biphenyl structure, indicating the presence of two phenyl rings connected by a central methylene bridge, contributing to its unique properties. The presence of multiple functional groups suggests potential applications in polymer chemistry, particularly in the synthesis of epoxy resins and other advanced materials. The compound's structure may impart specific physical properties such as increased rigidity and thermal stability, making it suitable for various industrial applications. Additionally, the oxirane group can participate in ring-opening reactions, allowing for further functionalization and modification. Safety considerations are essential when handling this compound, as epoxides can be reactive and may pose health risks if not managed properly. Overall, this compound exemplifies the complexity and versatility of organic chemistry in developing materials with tailored properties.

Formula: C₁₈H₁₈O₂

InChI: InChI=1S/C18H18O2/c1-5-15(6-2-13(1)9-17-11-19-17)16-7-3-14(4-8-16)10-18-12-20-18/h1-8,17-18H,9-12H2

InChI key: InChIKey=ZSAICLUIVSNXGW-UHFFFAOYSA-N

SMILES: C(C1=CC=C(C=C1)C2=CC=C(CC3CO3)C=C2)C4CO4

Synonyms:

• Oxirane, 2,2′-[[1,1′-biphenyl]-4,4′-diylbis(methylene)]bis-

4,4'-BIS(OXIRAN-2-YLMETHYL)-1,1'-BIPHENYL

CAS: 81591-83-5

Purity: 95.0%

Molecular weight: 266.3399963378906

Ref: 10-F533149