CAS 81595-00-8

[5-(4-methylphenyl)-2H-tetrazol-2-yl]acetic acid

Description:

[5-(4-methylphenyl)-2H-tetrazol-2-yl]acetic acid, with the CAS number 81595-00-8, is a chemical compound characterized by its tetrazole ring structure, which is a five-membered ring containing four nitrogen atoms and one carbon atom. This compound features a 4-methylphenyl group, contributing to its aromatic properties, and an acetic acid functional group, which imparts acidic characteristics. The presence of the tetrazole moiety often enhances the compound's biological activity, making it of interest in pharmaceutical research. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the carboxylic acid group. The compound's unique structure allows for potential interactions in biological systems, which can be explored for various applications, including drug development. As with many organic compounds, its stability, reactivity, and potential applications can be influenced by factors such as pH, temperature, and the presence of other chemical species.

Formula: C₁₀H₉N₄O₂

InChI: InChI=1/C10H10N4O2/c1-7-2-4-8(5-3-7)10-11-13-14(12-10)6-9(15)16/h2-5H,6H2,1H3,(H,15,16)/p-1

SMILES: Cc1ccc(cc1)c1nnn(CC(=O)O)n1

Synonyms:

• 2-[5-(4-methylphenyl)-2H-1,2,3,4-tetraazol-2-yl]acetic acid
• 2H-Tetrazole-2-acetic acid, 5-(4-methylphenyl)-
• [5-(4-Methylphenyl)-2H-tetrazol-2-yl]acetic acid

2-(5-(p-Tolyl)-2H-tetrazol-2-yl)acetic acid

CAS: 81595-00-8

Formula: C₁₀H₁₀N₄O₂

Molecular weight: 218.2120

Ref: IN-DA0058E8