CAS 81597-54-8

5-Bromo-N-(1-methylethyl)-2-thiophenesulfonamide

Description:

5-Bromo-N-(1-methylethyl)-2-thiophenesulfonamide is a chemical compound characterized by its unique structure, which includes a bromine atom, a thiophene ring, and a sulfonamide functional group. The presence of the bromine atom contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, imparts distinct electronic properties and can influence the compound's biological activity. The sulfonamide group is known for its role in pharmaceuticals, particularly as antibacterial agents. This compound may exhibit solubility in polar solvents due to the sulfonamide moiety, while the thiophene ring may enhance lipophilicity. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and reactivity can be influenced by the presence of the isopropyl group, which may affect its interaction with biological targets. Overall, 5-Bromo-N-(1-methylethyl)-2-thiophenesulfonamide represents a versatile scaffold for further chemical exploration and potential therapeutic applications.

Formula: C₇H₁₀BrNO₂S₂

InChI: InChI=1S/C7H10BrNO2S2/c1-5(2)9-13(10,11)7-4-3-6(8)12-7/h3-5,9H,1-2H3

InChI key: InChIKey=CDWTZOFXZRAQLW-UHFFFAOYSA-N

SMILES: S(NC(C)C)(=O)(=O)C=1SC(Br)=CC1

Synonyms:

• 2-Thiophenesulfonamide, 5-bromo-N-(1-methylethyl)-
• 5-Bromo-N-(1-methylethyl)-2-thiophenesulfonamide

5-BroMo-thiophene-2-sulfonic acid isopropylaMide

CAS: 81597-54-8

Formula: C₇H₁₀BrNO₂S₂

Purity: 95%

Molecular weight: 284.1938

Ref: IN-DA00GJKU