
CAS 81600-06-8
:Vintriptol
Description:
Vintriptol, identified by the CAS number 81600-06-8, is a chemical compound that has garnered attention in the field of medicinal chemistry. It is primarily known for its potential therapeutic applications, particularly in the treatment of certain neurological disorders. The compound exhibits a unique molecular structure that contributes to its biological activity, although specific details about its mechanism of action may vary. Vintriptol is characterized by its solubility properties, which can influence its bioavailability and efficacy in clinical settings. Additionally, it may interact with various biological targets, leading to a range of pharmacological effects. As with many compounds in drug development, understanding its pharmacokinetics, toxicity, and side effects is crucial for assessing its safety and effectiveness. Ongoing research continues to explore its full potential and optimize its use in therapeutic applications. However, detailed information regarding its specific characteristics, such as molecular weight, melting point, and spectral data, would require access to specialized chemical databases or literature.
Formula:C56H68N6O9
InChI:InChI=1S/C56H68N6O9/c1-7-52(67)28-33-29-55(51(66)70-6,45-37(19-23-61(31-33)32-52)36-16-11-13-18-41(36)58-45)39-26-38-43(27-44(39)69-5)60(4)48-54(38)21-24-62-22-14-20-53(8-2,47(54)62)49(64)56(48,68)50(65)59-42(46(63)71-9-3)25-34-30-57-40-17-12-10-15-35(34)40/h10-18,20,26-27,30,33,42,47-49,57-58,64,67-68H,7-9,19,21-25,28-29,31-32H2,1-6H3,(H,59,65)
InChI key:InChIKey=IQDSXWRQCKDBMW-UHFFFAOYSA-N
SMILES:C(C)C12C3C4(C(C(C(NC(CC=5C=6C(NC5)=CC=CC6)C(OCC)=O)=O)(O)C1O)N(C)C=7C4=CC(=C(OC)C7)C8(C(OC)=O)C9=C(C=%10C(N9)=CC=CC%10)CCN%11CC(C8)CC(CC)(O)C%11)CCN3CC=C2
Synonyms:- 2H-3,7-Methanoazacycloundecino[5,4-b]indole, vincaleukoblastine deriv.
- 1H-Indolizino[8,1-cd]carbazole, vincaleukoblastine deriv.
- Vincaleukoblastine, O4-deacetyl-3-de(methoxycarbonyl)-3-[[[(1S)-2-ethoxy-1-(1H-indol-3-ylmethyl)-2-oxoethyl]amino]carbonyl]-
- O4-Deacetyl-3-de(methoxycarbonyl)-3-[[[(1S)-2-ethoxy-1-(1H-indol-3-ylmethyl)-2-oxoethyl]amino]carbonyl]vincaleukoblastine
- Vincaleukoblastine, O4-deacetyl-3-de(methoxycarbonyl)-3-[[[2-ethoxy-1-(1H-indol-3-ylmethyl)-2-oxoethyl]amino]carbonyl]-, [3(S)]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Vintriptol
CAS:<p>Vintriptol is a biochemical.</p>Formula:C56H68N6O9Color and Shape:SolidMolecular weight:969.193
