CAS 81606-31-7
:4,5-Dibromothiophene-2-sulfonyl chloride
Description:
4,5-Dibromothiophene-2-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group attached to a thiophene ring that is substituted with bromine atoms. This compound typically appears as a solid at room temperature and is known for its reactivity due to the presence of the sulfonyl chloride group, which can participate in nucleophilic substitution reactions. The bromine substituents enhance its electrophilic character, making it useful in various synthetic applications, particularly in the preparation of more complex organic molecules. It is soluble in organic solvents such as dichloromethane and chloroform but is generally less soluble in water. Safety precautions are necessary when handling this compound, as it can be corrosive and may release toxic gases upon reaction with water or moisture. Its applications are often found in the fields of organic synthesis, pharmaceuticals, and materials science, where it serves as an intermediate in the synthesis of various functionalized compounds.
Formula:C4HBr2ClO2S2
InChI:InChI=1/C4HBr2ClO2S2/c5-2-1-3(10-4(2)6)11(7,8)9/h1H
SMILES:c1c(c(Br)sc1S(=O)(=O)Cl)Br
Synonyms:- 2-Thiophenesulfonyl Chloride, 4,5-Dibromo-
- 4,5-Dibromothiophene-2-sulfonyl chloride
- 2,3-Dibromothiophene-5-sulphonyl chloride
- 4,5-DIBROMOTHIOPHENE-2-SULPHONYL CHLORIDE
- BUTTPARK 93\50-57
- 4,5-Dibromothiophene-2-sulfonic acid chloride
- 4,5-Dibromo-2-thiophenesulfonyl chloride
- 2,3-Dibromothiophene-5-sulfonylchloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4,5-Dibromothiophene-2-sulfonyl chloride, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C4HBr2ClO2S2Purity:97%Color and Shape:Powder, White to pale creamMolecular weight:340.454,5-Dibromothiophene-2-sulfonyl chloride
CAS:Formula:C4HBr2ClO2S2Purity:97%Color and Shape:SolidMolecular weight:340.44054,5-Dibromothiophene-2-sulphonyl chloride
CAS:4,5-Dibromothiophene-2-sulphonyl chlorideFormula:C4HBr2ClO2S2Purity:≥95%Color and Shape: light brown powderMolecular weight:340.44g/mol


