CAS 81608-30-2
:Neuromedin C
Description:
Neuromedin C is a neuropeptide that plays a significant role in various physiological processes, particularly in the central nervous system and gastrointestinal tract. It is composed of a sequence of amino acids and is classified as a member of the neuromedin family, which are involved in neurotransmission and modulation of various bodily functions. Neuromedin C is known to influence smooth muscle contraction, promote vasodilation, and modulate pain perception. Its action is mediated through specific receptors, contributing to its role in regulating functions such as blood pressure, digestion, and neuroendocrine responses. The peptide is synthesized in the body and can be found in various tissues, including the brain and gastrointestinal tract. Research into Neuromedin C continues to explore its potential therapeutic applications, particularly in conditions related to the nervous system and gastrointestinal disorders. Its CAS number, 81608-30-2, is a unique identifier that facilitates the identification and study of this compound in scientific literature and databases.
Formula:C50H73N17O11S
InChI:InChI=1/C50H73N17O11S/c1-25(2)13-34(46(74)63-33(43(53)71)11-12-79-6)64-47(75)36(15-29-20-54-23-58-29)62-41(70)22-57-50(78)42(26(3)4)67-44(72)27(5)60-45(73)35(14-28-19-56-32-10-8-7-9-31(28)32)65-48(76)37(16-30-21-55-24-59-30)66-49(77)38(17-39(52)68)61-40(69)18-51/h7-10,19-21,23-27,33-38,42,56H,11-18,22,51H2,1-6H3,(H2,52,68)(H2,53,71)(H,54,58)(H,55,59)(H,57,78)(H,60,73)(H,61,69)(H,62,70)(H,63,74)(H,64,75)(H,65,76)(H,66,77)(H,67,72)/t27-,33-,34-,35-,36-,37-,38-,42-/m0/s1
SMILES:CC(C)C[C@@H](C(=N[C@@H](CCSC)C(=N)O)O)N=C([C@H](Cc1cnc[nH]1)N=C(CN=C([C@H](C(C)C)N=C([C@H](C)N=C([C@H](Cc1c[nH]c2ccccc12)N=C([C@H](Cc1cnc[nH]1)N=C([C@H](CC(=N)O)N=C(CN)O)O)O)O)O)O)O)O
Synonyms:- Bombesin decapeptide
- Canine gastrin-releasing peptide 10
- Gastrin releasing peptide (18-27)
- Gastrin releasing peptide 10
- Gly-asn-his-trp-ala-val-gly-his-leu-met-NH2
- Grp (18-27)
- Grp-10
- (2S)-2-[(2-aminoacetyl)amino]-N-[(1S)-2-[[(1S)-2-[[(1S)-2-[[(1S)-1-[[2-[[(1S)-2-[[(1S)-1-[[(1S)-1-carbamoyl-3-methylsulfanyl-propyl]carbamoyl]-3-methyl-butyl]amino]-1-(3H-imidazol-4-ylmethyl)-2-oxo-ethyl]amino]-2-oxo-ethyl]carbamoyl]-2-methyl-propyl]amino]-1-methyl-2-oxo-ethyl]amino]-1-(1H-indol-3-ylmethyl)-2-oxo-ethyl]amino]-1-(3H-imidazol-4-ylmethyl)-2-oxo-ethyl]butanediamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
GRP (18-27) (human, porcine, canine)
CAS:Bombesin-like peptide from porcine spinal cord; exhibits a potent stimulant effect on smooth muscle of rat uterus. Neuromedin C microinjected into the amygdala inhibited feeding in rats.Formula:C50H73N17O11SPurity:97.8%Color and Shape:White PowderMolecular weight:1120.3NEUROMEDIN C
CAS:Formula:C50H73N17O11SPurity:97%Color and Shape:SolidMolecular weight:1120.286920000001

