CAS 81613-60-7
:Flupropadine hydrochloride
Description:
Flupropadine hydrochloride is a chemical compound primarily recognized for its application as an antihistamine, particularly in the treatment of allergic conditions. It belongs to the class of piperidine derivatives and exhibits properties that help alleviate symptoms associated with allergies, such as sneezing, itching, and runny nose. The compound is characterized by its ability to selectively block histamine H1 receptors, which play a crucial role in the allergic response. Flupropadine hydrochloride is typically administered in oral form and is known for its relatively low sedative effects compared to other antihistamines, making it a preferred choice for patients who require relief without significant drowsiness. In terms of its chemical structure, it features a piperidine ring and various functional groups that contribute to its pharmacological activity. As with any medication, it is essential to consider potential side effects and contraindications, and its use should be guided by a healthcare professional.
Formula:C20H23F6N·ClH
InChI:InChI=1S/C20H23F6N.ClH/c1-18(2,3)15-6-9-27(10-7-15)8-4-5-14-11-16(19(21,22)23)13-17(12-14)20(24,25)26;/h11-13,15H,6-10H2,1-3H3;1H
InChI key:InChIKey=NLECRQYFKWPVEQ-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CC(C(F)(F)F)=CC(C#CCN2CCC(C(C)(C)C)CC2)=C1.Cl
Synonyms:- 279-786-4
- Flupropadine hydrochloride
- Piperidine, 1-[3-[3,5-bis(trifluoromethyl)phenyl]-2-propyn-1-yl]-4-(1,1-dimethylethyl)-, hydrochloride (1:1)
- Piperidine, 1-[3-[3,5-bis(trifluoromethyl)phenyl]-2-propynyl]-4-(1,1-dimethylethyl)-, hydrochloride
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Flupropadine Hydrochloride-d4
CAS:Controlled ProductFormula:C20D4H19F6N·HClColor and Shape:NeatMolecular weight:431.879Flupropadine Hydrochloride
CAS:Controlled ProductFormula:C20H23F6N·HClColor and Shape:NeatMolecular weight:427.855
