CAS 81624-55-7

N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine

Description:

N,N,N',N'-tetrakis[(6-methyl-1H-benzimidazol-2-yl)methyl]ethane-1,2-diamine is a complex organic compound characterized by its tetrakis-substituted ethane backbone, which features four 6-methyl-1H-benzimidazol-2-yl groups attached via methylene linkages. This compound exhibits significant chelating properties due to the presence of the benzimidazole moieties, which can coordinate with metal ions, making it potentially useful in coordination chemistry and catalysis. The presence of multiple amine groups enhances its solubility in polar solvents and may contribute to its biological activity, possibly allowing for interactions with various biological targets. The structural complexity and functional groups suggest that it may exhibit interesting properties such as fluorescence or antimicrobial activity, although specific applications would depend on further research. Its CAS number, 81624-55-7, allows for easy identification in chemical databases, facilitating access to additional information regarding its synthesis, properties, and potential uses in various fields, including medicinal chemistry and materials science.

Formula: C₃₈H₄₀N₁₀

InChI: InChI=1/C38H40N10/c1-23-5-9-27-31(15-23)43-35(39-27)19-47(20-36-40-28-10-6-24(2)16-32(28)44-36)13-14-48(21-37-41-29-11-7-25(3)17-33(29)45-37)22-38-42-30-12-8-26(4)18-34(30)46-38/h5-12,15-18H,13-14,19-22H2,1-4H3,(H,39,43)(H,40,44)(H,41,45)(H,42,46)

SMILES: Cc1ccc2c(c1)[nH]c(CN(CCN(Cc1nc3ccc(C)cc3[nH]1)Cc1nc3ccc(C)cc3[nH]1)Cc1nc3ccc(C)cc3[nH]1)n2

NSC-348884

CAS: 81624-55-7

Formula: C₃₈H₄₀N₁₀

Purity: 98%

Color and Shape: Solid

Molecular weight: 636.7912

Ref: IN-DA00G3SN

NSC348884

CAS: 81624-55-7

NSC348884

Purity: ≥98%

Molecular weight: 636.79g/mol

Ref: 54-BUP09943

NSC348884

CAS: 81624-55-7

NSC348884, a nucleophosmin inhibitor, disrupts oligomers, induces apoptosis, and inhibits cancer cell growth (IC50: 1.7-4.0 μM).

Formula: C₃₈H₄₀N₁₀

Purity: 98.69% - 99.91%

Color and Shape: Solid

Molecular weight: 636.79

Ref: TM-T6909

NSC348884

Controlled Product

CAS: 81624-55-7

Formula: C₃₈H₄₀N₁₀

Color and Shape: Neat

Molecular weight: 636.791

Ref: TR-N900560

NSC348884

CAS: 81624-55-7

NSC348884 is a novel anti-cancer drug that is an inhibitor of RNA polymerase. It has been shown to inhibit cellular transformation and viability in human leukemia HL-60 cells and prostate cancer cells, as well as inducing apoptosis. The mechanism of action of NSC348884 may be mediated through the induction of reactive oxygen species (ROS), activation of caspases, and modulation of signal transduction pathways. NSC348884 has also been shown to induce a variety of transcriptional effects on tumor cells, including upregulation or downregulation of genes involved in cell cycle regulation and apoptosis. This drug is also efficacious against brain tumors with malignant characteristics and breast cancer cells that are resistant to monoclonal antibody therapy.

Formula: C₃₈H₄₀N₁₀

Purity: Min. 95%

Molecular weight: 636.79 g/mol

Ref: 3D-GDA62455