
CAS 816430-02-1
:Ethyl α-[[(1,1-dimethylethoxy)carbonyl]amino]cyclobutanepropanoate
Description:
Ethyl α-[[[1,1-dimethylethoxy]carbonyl]amino]cyclobutanepropanoate, identified by its CAS number 816430-02-1, is a chemical compound characterized by its complex structure, which includes an ethyl ester functional group and a cyclobutane ring. This compound features a dimethylethoxycarbonyl group, which contributes to its stability and solubility in organic solvents. The presence of the amino group indicates potential for reactivity, particularly in forming amide bonds or participating in nucleophilic reactions. Its cyclobutane moiety adds rigidity to the molecular structure, influencing its physical properties and reactivity. Typically, compounds of this nature are of interest in synthetic organic chemistry and may serve as intermediates in the synthesis of pharmaceuticals or agrochemicals. The specific characteristics, such as melting point, boiling point, and solubility, would depend on the compound's purity and the conditions under which it is studied. Overall, this compound exemplifies the diverse functionalities that can be incorporated into organic molecules for various applications.
Formula:C14H25NO4
InChI:InChI=1S/C14H25NO4/c1-5-18-12(16)11(9-10-7-6-8-10)15-13(17)19-14(2,3)4/h10-11H,5-9H2,1-4H3,(H,15,17)
InChI key:InChIKey=ZZEKOOXFJPVELS-UHFFFAOYSA-N
SMILES:C(CC1CCC1)(NC(OC(C)(C)C)=O)C(OCC)=O
Synonyms:- Ethyl 2-(tert-butoxycarbonylamino)-3-cyclobutylpropanoate
- Cyclobutanepropanoic acid, α-[[(1,1-dimethylethoxy)carbonyl]amino]-, ethyl ester
- Ethyl α-[[(1,1-dimethylethoxy)carbonyl]amino]cyclobutanepropanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2-((tert-butoxycarbonyl)amino)-3-cyclobutylpropanoate
CAS:Formula:C14H25NO4Molecular weight:271.3526
