
CAS 816449-71-5
:3-Hydroxy-5-(hydroxymethyl)benzoic acid
Description:
3-Hydroxy-5-(hydroxymethyl)benzoic acid, also known by its CAS number 816449-71-5, is an organic compound characterized by a benzoic acid structure with two functional groups: a hydroxyl group (-OH) and a hydroxymethyl group (-CH2OH) attached to the aromatic ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. Its chemical properties are influenced by the acidity of the carboxylic acid group and the reactivity of the hydroxymethyl group, making it a potential candidate for various chemical reactions, including esterification and oxidation. The compound may exhibit biological activity, which could be of interest in pharmaceutical applications or as a biochemical probe. Additionally, its structural features suggest potential uses in materials science or as a building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C8H8O4
InChI:InChI=1S/C8H8O4/c9-4-5-1-6(8(11)12)3-7(10)2-5/h1-3,9-10H,4H2,(H,11,12)
InChI key:InChIKey=JZPTVPKKKYRWLI-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(CO)=CC(O)=C1
Synonyms:- 3-Hydroxy-5-(hydroxymethyl)benzoic acid
- Benzoic acid, 3-hydroxy-5-(hydroxymethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.