CAS 816469-55-3

2-cyclohexylacetamidine hydrochloride

Description:

2-Cyclohexylacetamidine hydrochloride is a chemical compound characterized by its amidine functional group, which features a nitrogen atom bonded to a carbon atom that is also connected to a cyclohexyl group and an acetamido moiety. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, making it versatile for different applications. The presence of the hydrochloride salt form enhances its stability and solubility in aqueous solutions. 2-Cyclohexylacetamidine hydrochloride may exhibit biological activity, potentially serving as a pharmacological agent or a building block in organic synthesis. Its structure allows for interactions with biological targets, which may lead to various therapeutic effects. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound's unique structural features contribute to its utility in research and development within the fields of medicinal chemistry and drug discovery.

Formula: C₈H₁₇ClN₂

InChI: InChI=1/C8H16N2.ClH/c9-8(10)6-7-4-2-1-3-5-7;/h7H,1-6H2,(H3,9,10);1H

SMILES: C1CCC(CC1)CC(=N)N.Cl

Synonyms:

• 2-Cyclohexyl-acetamidine HCl
• 816469-55-3

2-Cyclohexylethanimidamide hydrochloride

CAS: 816469-55-3

Versatile small molecule scaffold

Formula: C₈H₁₇ClN₂

Purity: Min. 95%

Molecular weight: 176.69 g/mol

Ref: 3D-RHB46955